| Molecular weights calculated on 12/14/24 |
| 1 2 3 4 5 6 7 8 9 10 11 12 |
Molar mass of CH4 is 16.04246 g/mol
Molar mass of Al is 26.9815386 g/mol
Molar mass of Na2CO3 is 105.98843856 g/mol
Molar mass of C8H8N4O2HCL is 192.17472 g/mol
Molar mass of CoO2 is 90.931995 g/mol
Molar mass of C20H18Cl2N2O2 is 389.27512 g/mol
Molar mass of CoO2 is 90.931995 g/mol
Molar mass of H80 is 80.6352 g/mol
Molar mass of H8O is 24.06292 g/mol
Molar mass of ZnO is 81.3794 g/mol
Molar mass of Al is 26.9815386 g/mol
Molar mass of Hg2Cl2 is 472.086 g/mol
Molar mass of Na is 22.98976928 g/mol
Molar mass of Метан is 16.04246 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of 乙醇 is 46.06844 g/mol
Molar mass of 水 is 18.01528 g/mol
Molar mass of CoO2 is 90.931995 g/mol
Molar mass of hgO is 216.5894 g/mol
Molar mass of K2SO4 is 174.2592 g/mol
Molar mass of C3H8O is 60.09502 g/mol
Molar mass of c7h7NH(C11N2O3H20)48(C9NO3H15)48H is 19955.55626 g/mol
Molar mass of c7h7NH(C11N2O3H20)24(C9NO3H15)24H is 10031.35466 g/mol
Molar mass of 10H2O is 180.1528 g/mol
Molar mass of c7h7NH(C11N2O3H20)16(C9NO3H15)16H is 6723.28746 g/mol
Molar mass of c7h7NH(C11N2O3H20)12(C9NO3H15)12H is 5069.25386 g/mol
Molar mass of (m)CaCO3 is 100.0869 g/mol
Molar mass of NaNO2 is 68.99526928 g/mol
Molar mass of Na2HPO4 is 141.95884056 g/mol
Molar mass of NH4OH is 35.0458 g/mol
Molar mass of C3Cl8 is 319.6561 g/mol
Molar mass of na2co3 is 105.98843856 g/mol
Molar mass of C4h8c12s is 232.29972 g/mol
Molar mass of CuSO4 is 159.6086 g/mol
Molar mass of b6h6 is 70.91364 g/mol
Molar mass of 水 is 18.01528 g/mol
Molar mass of NO is 30.0061 g/mol
Molar mass of P2O3 is 109.945724 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of C2H5OH is 46.06844 g/mol
Molar mass of n2 is 28.0134 g/mol
Molar mass of C2H5OH is 46.06844 g/mol
Molar mass of Ca(PO4) is 135.049362 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of BF3(ewwwwwwxxxxx)3 is 637.7583056 g/mol
Molar mass of BF3(ewwwwwwxxxxx)3 is 637.7583056 g/mol
Molar mass of BF3(ewwwwwwxxxxx)3 is 637.7583056 g/mol
Molar mass of BF3(ewwwwwwxxxxx)3 is 637.7583056 g/mol
| 1 2 3 4 5 6 7 8 9 10 11 12 |
| Molecular weights calculated on 12/14/24 |
Molecular masses on 11/15/24
Molecular masses on 12/15/23
Please let us know how we can improve this web app.
