Molecular weights calculated on 04/28/21 | Molecular weights calculated on 04/30/21 |
Molar mass of CH3OH is 32.04186 g/mol
Molar mass of P2O5 is 141.944524 g/mol
Molar mass of H3PO4 is 97.995182 g/mol
Molar mass of CaCO3 is 100.0869 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of [Na][C3H5O3][C15H31CO][C17H31CO][C17H33CO] is 880.36866928 g/mol
Molar mass of MgCl26 is NH4 g/mol
Molar mass of Ca3Na2 is 166.21353856 g/mol
Molar mass of KOH is 56.10564 g/mol
Molar mass of Na2S is 78.04453856 g/mol
Molar mass of C6H8 is 80.12772 g/mol
Molar mass of Fe2(SO4)3 is 399.8778 g/mol
Molar mass of Rh is 102.9055 g/mol
Molar mass of BeF2 is 47.0089884 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of Na2 is 45.97953856 g/mol
Molar mass of BeF2 is 47.0089884 g/mol
Molar mass of NH4 is 2SO3 g/mol
Molar mass of SO2 is 64.0638 g/mol
Molar mass of H3PO4 is 97.995182 g/mol
Molar mass of Fe3S4 is 295.795 g/mol
Molar mass of [Na][C3H5O3][C15H31CO][C17H31CO][C17H35CO] is 882.38454928 g/mol
Molar mass of K3[Fe(C2O4)3]*3H2O is 491.24274 g/mol
Molar mass of P is 30.973762 g/mol
Molar mass of La7Sr3Mn10O30 is 2264.56074 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of [K][C3H5O3][C15H31CO][C17H31CO][C17H35CO] is 898.49308 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of Cl3na2 is 152.33853856 g/mol
Molar mass of Ca3(PO4)2 is 310.176724 g/mol
Molar mass of NaBr is 102.89376928 g/mol
Molar mass of Ba(oh)2 is 171.34168 g/mol
Molar mass of [Na][C3H5O3][C15H31CO][C17H31CO][C17H35CO] is 882.38454928 g/mol
Molar mass of C14H9Cl5 is 354.48626 g/mol
Molar mass of Na is 22.98976928 g/mol
Molar mass of Ac(OH)3 is 278.0497721 g/mol
Molar mass of O2 is 31.9988 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of Ca3na2 is 166.21353856 g/mol
Molar mass of Fe2(CO3)3 is 291.7167 g/mol
Molar mass of NaHCO3 is 84.00660928 g/mol
Molar mass of S2Fe3 is 231.665 g/mol
Molar mass of HNO3 is 63.01284 g/mol
Molar mass of HNO is 31.01404 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of Cr2O3 is 151.9904 g/mol
Molar mass of LaMnO3 is 241.841715 g/mol
Molar mass of HNO is 31.01404 g/mol
Calculate molecular weight
Molecular weights calculated on 04/28/21 | Molecular weights calculated on 04/30/21 |
Molecular masses on 03/30/21
Molecular masses on 04/29/20
Please let us know how we can improve this web app.