| Molecular weights calculated on 03/23/21 | Molecular weights calculated on 03/25/21 |
Molar mass of Cu(C14H12N2)2(C7H5N4)2(H2O)2 is 806.37632 g/mol
Molar mass of H2so4 is 98.07848 g/mol
Molar mass of H3PO4 is 97.995182 g/mol
Molar mass of H7 is 7.05558 g/mol
Molar mass of H is 1.00794 g/mol
Molar mass of BiCl3 is 315.3394 g/mol
Molar mass of S is 32.065 g/mol
Molar mass of C5H12O5 is 152.14578 g/mol
Molar mass of CaCl2 is 110.984 g/mol
Calculate molecular weight
| Molecular weights calculated on 03/23/21 | Molecular weights calculated on 03/25/21 |
Molecular masses on 02/22/21
Molecular masses on 03/24/20
Please let us know how we can improve this web app.
