Molecular weights calculated on 01/14/21 | Molecular weights calculated on 01/16/21 |
Molar mass of h3po4 is 97.995182 g/mol
Molar mass of H3BO3 is 61.83302 g/mol
Molar mass of sodium is 22.98976928 g/mol
Molar mass of *Ba(ClO3)2 is 304.2294 g/mol
Molar mass of Na3PO4 is 163.94066984 g/mol
Molar mass of *H2SO4 is 98.07848 g/mol
Molar mass of c is 12.0107 g/mol
Molar mass of P is 30.973762 g/mol
Molar mass of Cl2 is 70.906 g/mol
Molar mass of h is 1.00794 g/mol
Molar mass of CH3(CH3) is 30.06904 g/mol
Molar mass of H2CO3 is 62.02478 g/mol
Molar mass of o is 15.9994 g/mol
Molar mass of PO is 208.9824304 g/mol
Molar mass of Fe2(SO4)3 is 399.8778 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of O is 15.9994 g/mol
Molar mass of NaCI is 161.90493928 g/mol
Molar mass of *BaSO4 is 233.3896 g/mol
Molar mass of CH3SH is 48.10746 g/mol
Molar mass of TiCl4 is 189.679 g/mol
Molar mass of *HClO3 is 84.45914 g/mol
Molar mass of Ne is 20.1797 g/mol
Molar mass of O2 is 31.9988 g/mol
Molar mass of Na2SO4 is 142.04213856 g/mol
Molar mass of CuSO4 is 159.6086 g/mol
Molar mass of Cr(C10H8N2)2H2OOVO(C2O4)2 is 641.35752 g/mol
Molar mass of *2HClO3 is 168.91828 g/mol
Molar mass of Cr(C10H8N2)2H2O is 382.37922 g/mol
Molar mass of C9H8O4 is 180.15742 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of Cr(C10H8N2)2 is 364.36394 g/mol
Molar mass of Cr(C10H8N2) is 208.18002 g/mol
Molar mass of H is 1.00794 g/mol
Molar mass of (C10H8N2) is 156.18392 g/mol
Molar mass of OVO(C2O4)2 is 258.9783 g/mol
Molar mass of MgSO4*7H2O is 246.47456 g/mol
Molar mass of He is 4.002602 g/mol
Molar mass of OVO is 82.9403 g/mol
Molar mass of e is 0.000548579909462 g/mol
Molar mass of CH2OHCHOHCHOHCH2OH is 122.1198 g/mol
Molar mass of Ca(OH)2 is 74.09268 g/mol
Molar mass of ca is 40.078 g/mol
Molar mass of KH2PO4 is 2H2O g/mol
Molar mass of Mg(OH)2 is 58.31968 g/mol
Molar mass of h is 1.00794 g/mol
Molar mass of cl2 is 70.906 g/mol
Molar mass of lif is 25.9394032 g/mol
Molar mass of Au2S is 425.998138 g/mol
Calculate molecular weight
Molecular weights calculated on 01/14/21 | Molecular weights calculated on 01/16/21 |
Molecular masses on 12/16/20
Molecular masses on 01/15/20
Please let us know how we can improve this web app.