Molecular weights calculated on 02/28/16 | Molecular weights calculated on 03/01/16 |
Molar mass of k2SO4 is 174.2592 g/mol
Molar mass of CO is 28.0101 g/mol
Molar mass of C6H12O6 is 180.15588 g/mol
Molar mass of CuMg is 87.851 g/mol
Molar mass of CuMg is 87.851 g/mol
Molar mass of H2O(g) is 18,01528 g/mol
Molar mass of C17H35COONa is 306.45906928 g/mol
Molar mass of B2O3 is 69.6202 g/mol
Molar mass of (NH4)3PO4 is 149.086742 g/mol
Molar mass of O2 is 31.9988 g/mol
Molar mass of Cl(OH)4 is 103,48236 g/mol
Molar mass of Fe(NO3)3 is 241.8597 g/mol
Molar mass of SeO2 is 110.9588 g/mol
Molar mass of Ba(ClO)2 is 240.2318 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of Cl2 is 70.906 g/mol
Molar mass of CH3OH is 32.04186 g/mol
Molar mass of NaCl is 58.44276928 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of C is 12.0107 g/mol
Molar mass of C7H16 is 100.20194 g/mol
Molar mass of K2SO4 is 10H2O g/mol
Molar mass of C7H8 is 92.13842 g/mol
Molar mass of CH3(CH2)4CHCHCH2CHCH(CH2)7COOH is 280,44548 g/mol
Molar mass of Ca(NO3)2 is 164.0878 g/mol
Molar mass of C6H7N is 93.12648 g/mol
Molar mass of XeO2 is 163.2918 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of AgNO3 is 169.8731 g/mol
Molar mass of (NH4)2SO4 is 132,13952 g/mol
Molar mass of K2SO410H2O is 6688,03088 g/mol
Molar mass of Cl2 is 70,906 g/mol
Molar mass of Al(OH3) is 46.0047586 g/mol
Molar mass of co2 is 117.86639 g/mol
Molar mass of Na2C16H9N4O9S2 is 511.37359856 g/mol
Molar mass of Cl2 is 70,906 g/mol
Molar mass of C3H8O3 is 92.09382 g/mol
Molar mass of (NH4)2SO4 is 132.13952 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of MnO2 is 86.936845 g/mol
Molar mass of Al(OH)3 is 78.0035586 g/mol
Molar mass of CaCO3 is 100.0869 g/mol
Molar mass of MgP2O7 is 198.248324 g/mol
Molar mass of NH4Cl is 53.49146 g/mol
Molar mass of Zn(OH)2 is 99.39468 g/mol
Molar mass of PtCl2(NH3)2 is 300,05104 g/mol
Molar mass of (NH4)2SO4 is 132.13952 g/mol
Calculate molecular weight
Molecular weights calculated on 02/28/16 | Molecular weights calculated on 03/01/16 |
Molecular masses on 01/30/16
Molecular masses on 03/01/15
Please let us know how we can improve this web app.