Molecular weights calculated on 02/23/16 | Molecular weights calculated on 02/25/16 |
Molar mass of H2O2 is 34.01468 g/mol
Molar mass of Co59 is 3477.058505 g/mol
Molar mass of ammonia is 17.03052 g/mol
Molar mass of Mg is 24.305 g/mol
Molar mass of Co(NH2CH2CH2NH2)2Cl3H4O2HCl is 357.980335 g/mol
Molar mass of h is 1.00794 g/mol
Molar mass of SeBr5 is 478.48 g/mol
Molar mass of Mg(NO3)2 is 148.3148 g/mol
Molar mass of Cu(NO3)2(H2O)3NaHCO3 is 325.60824928 g/mol
Molar mass of BF3 is 67.8062096 g/mol
Molar mass of k is 39.0983 g/mol
Molar mass of NaF2 is 60.98657568 g/mol
Molar mass of H2 is 2.01588 g/mol
Molar mass of NH4Br is 97.94246 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of NaI is 149.89423928 g/mol
Molar mass of Cu is 63.546 g/mol
Molar mass of CCI2F2 is 315.8271464 g/mol
Molar mass of KHCO3 is 100.11514 g/mol
Molar mass of Mg is 24.305 g/mol
Molar mass of Mg3(PO4)2 is 262,857724 g/mol
Molar mass of (NH4)2SO4 is 132.13952 g/mol
Molar mass of Co(NH2CH2CH2NH2)2Cl3H6O3 is 339.534675 g/mol
Molar mass of Na2CO3 is 105.98843856 g/mol
Molar mass of KAl(SO4)2*12H2O is 474.3883986 g/mol
Molar mass of XeF4 is 207.2866128 g/mol
Molar mass of Mg(OH)2 is 58.31968 g/mol
Molar mass of XeF6 is 245.2834192 g/mol
Molar mass of (C12)(O16) is 400.1188 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of CuO is 79,5454 g/mol
Molar mass of Ca(PO3)2 is 198.021924 g/mol
Molar mass of Ca(PO3) is 119.049962 g/mol
Molar mass of UF6(g) is 352.0193292 g/mol
Molar mass of UF6 is (g) g/mol
Molar mass of H3CH2OCH2CH3 is 62.1109 g/mol
Molar mass of Co(NO3)*6H2O is 229.029775 g/mol
Molar mass of H2s4 is 130.27588 g/mol
Molar mass of UF6 is 352.0193292 g/mol
Molar mass of Mg3(SbO3)2 is 412,4314 g/mol
Molar mass of HNO3 is 63,01284 g/mol
Molar mass of Co(NH2CH2CH2NH2)2Cl3H6O3HCl is 375.995615 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of SO is 48.0644 g/mol
Molar mass of SO2 is 64.0638 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of CaSO4 is 136.1406 g/mol
Molar mass of H3PO4 is 97.995182 g/mol
Calculate molecular weight
Molecular weights calculated on 02/23/16 | Molecular weights calculated on 02/25/16 |
Molecular masses on 01/25/16
Molecular masses on 02/24/15
Please let us know how we can improve this web app.