Molecular weights calculated on 02/09/16 | Molecular weights calculated on 02/11/16 |
Molar mass of PtCl2(NH3)2 is 300.05104 g/mol
Molar mass of H2SO4 is 98,07848 g/mol
Molar mass of CaCO3 is 100.0869 g/mol
Molar mass of CuCN is 89.5634 g/mol
Molar mass of Na3PO4 is 163.94066984 g/mol
Molar mass of CH3(CH2)18COOH is 312.5304 g/mol
Molar mass of NO3fe is 117,8499 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of Na2SO4 is 142.04213856 g/mol
Molar mass of H2o is 18.01528 g/mol
Molar mass of alI3 is 407.6949486 g/mol
Molar mass of K2SO is 126,261 g/mol
Molar mass of NaBr is 102.89376928 g/mol
Molar mass of O is 15.9994 g/mol
Molar mass of FeOH2 is 73.86028 g/mol
Molar mass of SO2 is 64.0638 g/mol
Molar mass of CH3(CH2)4(CHCH2)4(CH2)2COOH is 252.39232 g/mol
Molar mass of O is 15.9994 g/mol
Molar mass of O2 is 31.9988 g/mol
Molar mass of Cu(NO3)2 is 187.5558 g/mol
Molar mass of C14H12N2 is 208.25848 g/mol
Molar mass of Mg is 24,305 g/mol
Molar mass of Ca(OH)2 is 74.09268 g/mol
Molar mass of Ca(OH)2 is 74.09268 g/mol
Molar mass of CH3(CH2)16COOH is 284.47724 g/mol
Molar mass of NaCO3 is 82.99866928 g/mol
Molar mass of Ca(OH)2 is 74.09268 g/mol
Molar mass of Ca(OH)2 is 74.09268 g/mol
Molar mass of FeCl3 is 3NH4OH g/mol
Molar mass of K2CrO4 is 194.1903 g/mol
Molar mass of CH3(CH2)4(CHCH2)2(CH2)6COOH is 254.4082 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of AgNO3 is 169.8731 g/mol
Molar mass of (NH4)2CO3 is 96.08582 g/mol
Molar mass of (NH4)2SO4 is 132.13952 g/mol
Molar mass of Fe2O3 is 159.6882 g/mol
Molar mass of H2C6H6O6 is 176.12412 g/mol
Molar mass of NO is 30.0061 g/mol
Molar mass of CH4 is 16.04246 g/mol
Molar mass of CaCO3 is 100.0869 g/mol
Molar mass of (NH4)3PO4 is 149.086742 g/mol
Molar mass of CH3OH is 32.04186 g/mol
Molar mass of MnSO4 is 151.000645 g/mol
Molar mass of PbI2 is 461.00894 g/mol
Molar mass of C8H10N4O2 is 194.1906 g/mol
Molar mass of c is 12.0107 g/mol
Molar mass of C6H5NO2 is 123.1094 g/mol
Molar mass of AgNo3 is 885.17129 g/mol
Molar mass of NaOH is 39,99710928 g/mol
Calculate molecular weight
Molecular weights calculated on 02/09/16 | Molecular weights calculated on 02/11/16 |
Molecular masses on 01/11/16
Molecular masses on 02/10/15
Please let us know how we can improve this web app.