Molecular weights calculated on 02/24/15 | Molecular weights calculated on 02/26/15 |
Molar mass of LiClO3 is 90.3922 g/mol
Molar mass of BaCl2 is 208.233 g/mol
Molar mass of C7 is H4 g/mol
Molar mass of Ga2(SO3)3 is 379.6356 g/mol
Molar mass of Ga2(SO3)3 is 379.6356 g/mol
Molar mass of NH4Cl is 53.49146 g/mol
Molar mass of C10NH21Cr12Zn2F16(BuCO2)26 is 3843.1858512 g/mol
Molar mass of C7H4ClIO2 is 282.46293 g/mol
Molar mass of K2Cr2O7 is 294.1846 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of C13H14Br2N4O2 is DMS g/mol
Molar mass of potassium is chlorate g/mol
Molar mass of SiO2 is 60.0843 g/mol
Molar mass of K3PO4 is 212.266262 g/mol
Molar mass of Ca(NO3)2 is 164.0878 g/mol
Molar mass of Al2(SO4)3 is 342.1508772 g/mol
Molar mass of KMnO4 is 158.033945 g/mol
Molar mass of C13H14Br2N4O2 is 418.08386 g/mol
Molar mass of LiNO3 is 68.9459 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of HNO2 is 47.01344 g/mol
Molar mass of SiC is 40.0962 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of NH4Cl is 53.49146 g/mol
Molar mass of Ca(OH)2 is 74.09268 g/mol
Molar mass of C6H12O6 is 180.15588 g/mol
Molar mass of CS2 is 76.1407 g/mol
Molar mass of CS2 is 76.1407 g/mol
Molar mass of Fe is 55.845 g/mol
Molar mass of calcium is chloride g/mol
Molar mass of KAl(SO4)2*12H2O is 474.3883986 g/mol
Molar mass of SO2 is 64.0638 g/mol
Molar mass of NH3 is 17.03052 g/mol
Molar mass of co2 is 117.86639 g/mol
Molar mass of co2 is 117.86639 g/mol
Molar mass of MgCl2 is 95.211 g/mol
Molar mass of CO2 is 44.0095 g/mol
Molar mass of GaAs is 144.6446 g/mol
Molar mass of H2O is 18.01528 g/mol
Molar mass of Br2 is 159.808 g/mol
Molar mass of HCl is 36.46094 g/mol
Molar mass of I2 is 253.80894 g/mol
Molar mass of NH4 is 18.03846 g/mol
Molar mass of ammonia is 17.03052 g/mol
Molar mass of I is 126.90447 g/mol
Molar mass of P2O5 is 141.944524 g/mol
Molar mass of CFCl3 is 137.3681032 g/mol
Molar mass of NaOH is 39.99710928 g/mol
Molar mass of C2H6O2 is 62.06784 g/mol
Calculate molecular weight
Molecular weights calculated on 02/24/15 | Molecular weights calculated on 02/26/15 |
Molecular masses on 01/26/15
Molecular masses on 02/25/14
Please let us know how we can improve this web app.