| Molecular weights calculated on 06/11/10 | Molecular weights calculated on 06/13/10 |
| 1 2 3 4 5 6 7 8 9 |
Molar mass of PNCI2 is 310.8002082 g/mol
Molar mass of PNCI2 is 310.8002082 g/mol
Molar mass of (PNCI2)3 is 932.4006246 g/mol
Molar mass of (PNCI2)3 is 932.4006246 g/mol
Molar mass of C17H14O is 234.293948 g/mol
Molar mass of Na2HPO4 is 141.958967764 g/mol
Molar mass of Cs is 132.90545192 g/mol
Molar mass of KH2PO4 is 136.0856862 g/mol
Molar mass of CoCl2H12O6 is 237.9315395 g/mol
Molar mass of Bu4NCl is 277.918492 g/mol
Molar mass of Fe2O3 is 159.68869 g/mol
Molar mass of Mn02 is 109.876091 g/mol
Molar mass of Co(C6H15N3)(P4O12)(H2O)4Li((CH3)2CO) is 641.1073973 g/mol
Molar mass of Fe is 55.8452 g/mol
Molar mass of CaBr is 119.9825 g/mol
| 1 2 3 4 5 6 7 8 9 |
| Molecular weights calculated on 06/11/10 | Molecular weights calculated on 06/13/10 |
Molecular masses on 05/13/10
Molecular masses on 06/12/09
Please let us know how we can improve this web app.
