| Molecular weights calculated on 06/22/08 | Molecular weights calculated on 06/24/08 |
| 1 2 3 4 5 6 7 |
Molar mass of K3Ti(C2O4)3H10O5 is 519.29649 g/mol
Molar mass of C6O12 is 264.05784 g/mol
Molar mass of KAl(SO4)2 is 258.20628868 g/mol
Molar mass of KAl(SO4)2 is 258.20628868 g/mol
Molar mass of FeCl3 is 162.2048 g/mol
Molar mass of H2O is 18.015324 g/mol
Molar mass of (N(CH3)4)3Cr(C2O4)3(H2O)5 is 628.566232 g/mol
Molar mass of (N(CH3)4)3Cr(C2O4)3(H2O)4 is 610.550908 g/mol
Molar mass of (N(CH3)4)2Cr(C2O4)3(H2O)4 is 536.405704 g/mol
Molar mass of (N(CH3)4)2Cr(C2O4)3(H2O)5 is 554.421028 g/mol
Molar mass of (N(CH3)4)3Cr(C2O4)3(H2O)2 is 574.52026 g/mol
Molar mass of (N(CH3)4)3Cr(C2O4)3(H2O)1 is 556.504936 g/mol
Molar mass of H2SO4 is 98.079114 g/mol
Molar mass of FeCl3(H2O)6 is 270.296744 g/mol
Molar mass of K2C2O4H2O is 184.231224 g/mol
Molar mass of FeCl3(H2O)6 is 270.296744 g/mol
Molar mass of K2Nb(C2O4)4(H2O)4 is 595.241418 g/mol
Molar mass of K3Nb(C2O4)4(H2O)4 is 634.339728 g/mol
Molar mass of K4Nb(C2O4)4(H2O)4 is 673.438038 g/mol
Molar mass of K4Nb(C2O4)4(H2O)3 is 655.422714 g/mol
Molar mass of Ca5(PO4)3F is 504.30484985 g/mol
Molar mass of Pb3(PO4)2 is 811.5729644 g/mol
Molar mass of Ag3PO4 is 418.5761422 g/mol
Molar mass of CO2 is 44.00964 g/mol
Molar mass of Hg2I2 is 654.992946 g/mol
Molar mass of MgF2 is 62.3018665 g/mol
Molar mass of CO2 is 44.00964 g/mol
Molar mass of H is 1.007947 g/mol
Molar mass of Fe(C15H12N4)3 is 800.697032 g/mol
Molar mass of Fe(C15H12N4)3 is 800.697032 g/mol
Molar mass of Fe(C15H12N4)3(PF6)2 is 1090.6253954 g/mol
Molar mass of Fe(C15H12N4)3(PF6)2(CH3OH)2 is 1154.7093914 g/mol
Molar mass of CaB2H8 is 69.765376 g/mol
Molar mass of CaN2H4 is 72.123628 g/mol
Molar mass of Fe(C15H12N4)3(PF6)2(CH3OH)2(H2O)2 is 1190.7400394 g/mol
Molar mass of Ca2B2N2H12 is 141.889004 g/mol
Molar mass of MgB2H8 is 53.992036 g/mol
Molar mass of MgN2H4 is 56.350288 g/mol
Molar mass of Mg2B2N2H12 is 110.342324 g/mol
Molar mass of Fe2(C15H12N4)6(PF6)4(CH3OH)4(H2O)5 is 2399.4954028 g/mol
Molar mass of MgCaB2N2H12 is 126.115664 g/mol
Molar mass of KBH4 is 53.941798 g/mol
Molar mass of KNH2 is 55.120924 g/mol
Molar mass of K2BNH6 is 109.062722 g/mol
Molar mass of O2 is 31.99886 g/mol
Molar mass of Na is 22.989769282 g/mol
Molar mass of H2O is 18.015324 g/mol
Molar mass of CO2 is 44.00964 g/mol
Molar mass of KNO3 is 101.10332 g/mol
| 1 2 3 4 5 6 7 |
| Molecular weights calculated on 06/22/08 | Molecular weights calculated on 06/24/08 |
Molecular masses on 05/24/08
Molecular masses on 06/23/07
Please let us know how we can improve this web app.
