| Molecular weights calculated on 04/16/08 | Molecular weights calculated on 04/18/08 |
| 1 2 3 4 5 6 7 8 |
Molar mass of KI is 166.002783 g/mol
Molar mass of H2O is 18.015324 g/mol
Molar mass of Br2 is 159.8082 g/mol
Molar mass of NH3 is 17.030561 g/mol
Molar mass of AgClO4 is 207.31914 g/mol
Molar mass of C14H18N2O5 is 294.304556 g/mol
Molar mass of NaPO3 is 101.961821482 g/mol
Molar mass of K2CO3 is 138.20569 g/mol
Molar mass of C10H16O is 152.234382 g/mol
Molar mass of PCl3 is 137.3333622 g/mol
Molar mass of Br2 is 159.8082 g/mol
Molar mass of C4H6O2S is 118.155162 g/mol
Molar mass of HCl is 36.461147 g/mol
Molar mass of NH4OH is 35.045885 g/mol
Molar mass of CaCl2 is 110.9848 g/mol
Molar mass of CH4 is 16.042568 g/mol
Molar mass of SF6 is 146.0559195 g/mol
Molar mass of H2S is 34.081394 g/mol
Molar mass of Cl2 is 70.9064 g/mol
Molar mass of HI is 127.91242 g/mol
Molar mass of CH4 is 16.042568 g/mol
Molar mass of CO is 28.01021 g/mol
Molar mass of Ni(P(C6H5)2CH2CH2P(C6H5)2)Cl2 is 528.0183524 g/mol
Molar mass of H20 is 20.15894 g/mol
Molar mass of H2O is 18.015324 g/mol
Molar mass of Sr(NO3)2 is 211.63102 g/mol
Molar mass of Ca(OH)2 is 74.093154 g/mol
Molar mass of KOH is 56.105687 g/mol
Molar mass of KHC8H4O4 is 204.222005 g/mol
Molar mass of KHC8H4O4 is 204.222005 g/mol
Molar mass of NO3 is 62.00501 g/mol
Molar mass of Fe(NH4)2(SO4)26H2O is 2607.58126 g/mol
| 1 2 3 4 5 6 7 8 |
| Molecular weights calculated on 04/16/08 | Molecular weights calculated on 04/18/08 |
Molecular masses on 03/18/08
Molecular masses on 04/17/07
Please let us know how we can improve this web app.
