Printed from https://www.webqc.org

Molar Mass, Molecular Weight and Elemental Composition Calculator

Molar mass of C2H5C(O4PC2H5C2H4)6PO4C2H5C2H5 is 1106.6791 g/mol

Convert between C2H5C(O4PC2H5C2H4)6PO4C2H5C2H5 weight and moles
CompoundMolesWeight, g
C2H5C(O4PC2H5C2H4)6PO4C2H5C2H5

Elemental composition of C2H5C(O4PC2H5C2H4)6PO4C2H5C2H5
ElementSymbolAtomic weightAtomsMass percent
CarbonC12.01073133.6441
HydrogenH1.00794696.2844
PhosphorusP30.973762719.5916
OxygenO15.99942840.4800

Computing molar mass step by step

First, compute the number of each atom in C2H5C(O4PC2H5C2H4)6PO4C2H5C2H5:
C: 31, H: 69, P: 7, O: 28

Then, lookup atomic weights for each element in periodic table:
C: 12.0107, H: 1.00794, P: 30.973762, O: 15.9994

Now, compute the sum of products of number of atoms to the atomic weight:
Molar mass (C2H5C(O4PC2H5C2H4)6PO4C2H5C2H5) = ∑ Counti * Weighti =
Count(C) * Weight(C) + Count(H) * Weight(H) + Count(P) * Weight(P) + Count(O) * Weight(O) =
31 * 12.0107 + 69 * 1.00794 + 7 * 30.973762 + 28 * 15.9994 =
1106.6791 g/mol


Mass percent compositionAtomic percent composition

Related compounds
FormulaCompound name
CH5O3PMethylphosphonic acid
C2H7OPDimethylphosphine oxide
CH5O2PMethylphosphinic acid
C2H5OPOxaphosphetane
C3H7O6PGlyceraldehyde 3-phosphate
C3H7O7P3-Phosphoglyceric acid
C3H9O6PGlycerol 3-phosphate
C2H5O3PVinylphosphonic acid
C2H7O3PDimethylphosphite
C3H9O3PTris(hydroxymethyl)phosphine

Formula in Hill system is C31H69O28P7

Computing molar mass (molar weight)

To calculate molar mass of a chemical compound enter its formula and click 'Compute'. In chemical formula you may use:
  • Any chemical element. Capitalize the first letter in chemical symbol and use lower case for the remaining letters: Ca, Fe, Mg, Mn, S, O, H, C, N, Na, K, Cl, Al.
  • Functional groups: D, T, Ph, Me, Et, Bu, AcAc, For, Tos, Bz, TMS, tBu, Bzl, Bn, Dmg
  • parenthesis () or brackets [].
  • Common compound names.
Examples of molar mass computations: NaCl, Ca(OH)2, K4[Fe(CN)6], CuSO4*5H2O, nitric acid, potassium permanganate, ethanol, fructose, caffeine, water.

Molar mass calculator also displays common compound name, Hill formula, elemental composition, mass percent composition, atomic percent compositions and allows to convert from weight to number of moles and vice versa.

Computing molecular weight (molecular mass)

To calculate molecular weight of a chemical compound enter it's formula, specify its isotope mass number after each element in square brackets.
Examples of molecular weight computations: C[14]O[16]2, S[34]O[16]2.

Definitions

  • Molecular mass (molecular weight) is the mass of one molecule of a substance and is expressed in the unified atomic mass units (u). (1 u is equal to 1/12 the mass of one atom of carbon-12)
  • Molar mass (molar weight) is the mass of one mole of a substance and is expressed in g/mol.
  • Mole is a standard scientific unit for measuring large quantities of very small entities such as atoms and molecules. One mole contains exactly 6.022 ×1023 particles (Avogadro's number)

Steps to calculate molar mass

  1. Identify the compound: write down the chemical formula of the compound. For example, water is H2O, meaning it contains two hydrogen atoms and one oxygen atom.
  2. Find atomic masses: look up the atomic masses of each element present in the compound. The atomic mass is usually found on the periodic table and is given in atomic mass units (amu).
  3. Calculate molar mass of each element: multiply the atomic mass of each element by the number of atoms of that element in the compound.
  4. Add them together: add the results from step 3 to get the total molar mass of the compound.

Example: calculating molar mass

Let's calculate the molar mass of carbon dioxide (CO2):

  • Carbon (C) has an atomic mass of about 12.01 amu.
  • Oxygen (O) has an atomic mass of about 16.00 amu.
  • CO2 has one carbon atom and two oxygen atoms.
  • The molar mass of carbon dioxide is 12.01 + (2 × 16.00) = 44.01 g/mol.

Lesson on computing molar mass

Weights of atoms and isotopes are from NIST article.

Related: Molecular weights of amino acids

molecular weights calculated today
Please let us know how we can improve this web app.
Menu Balance Molar mass Gas laws Units Chemistry tools Periodic table Chemical forum Symmetry Constants Contribute Contact us
How to cite?
Choose languageDeutschEnglishEspañolFrançaisItalianoNederlandsPolskiPortuguêsРусский中文日本語한국어